C9H15F3N4O2 — CID 113463057
3-(N'-hydroxycarbamimidoyl)-N-(2,2,2-trifluoroethyl)piperidine-1-carboxamide (PubChem CID 113463057) has the molecular formula C9H15F3N4O2 and a molecular weight of 268.24 g/mol. Its IUPAC name is 3-(N'-hydroxycarbamimidoyl)-N-(2,2,2-trifluoroethyl)piperidine-1-carboxamide.
| Compound Name | 3-(N'-hydroxycarbamimidoyl)-N-(2,2,2-trifluoroethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 113463057 |
| Molecular Formula | C9H15F3N4O2 |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 3-(N'-hydroxycarbamimidoyl)-N-(2,2,2-trifluoroethyl)piperidine-1-carboxamide |
| SMILES | NC(=NO)C1CCCN(C(=O)NCC(F)(F)F)C1 |
| InChI | InChI=1S/C9H15F3N4O2/c10-9(11,12)5-14-8(17)16-3-1-2-6(4-16)7(13)15-18/h6,18H,1-5H2,(H2,13,15)(H,14,17) |
| InChIKey | HAOMCGJLMRQBSY-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|