C16H19F3N2O2 — CID 94098690
(3S)-1-(2-phenylacetyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide (PubChem CID 94098690) has the molecular formula C16H19F3N2O2 and a molecular weight of 328.33 g/mol. Its IUPAC name is (3S)-1-(2-phenylacetyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-(2-phenylacetyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 94098690 |
| Molecular Formula | C16H19F3N2O2 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (3S)-1-(2-phenylacetyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCC(F)(F)F)[C@H]1CCCN(C(=O)Cc2ccccc2)C1 |
| InChI | InChI=1S/C16H19F3N2O2/c17-16(18,19)11-20-15(23)13-7-4-8-21(10-13)14(22)9-12-5-2-1-3-6-12/h1-3,5-6,13H,4,7-11H2,(H,20,23)/t13-/m0/s1 |
| InChIKey | ASYRZHLFMJCMIV-ZDUSSCGKSA-N |
| XLogP | 2.15 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |