C21H28N2O5 — CID 120541562
4-[[[1-(2-phenylacetyl)piperidine-3-carbonyl]amino]methyl]oxane-4-carboxylic acid (PubChem CID 120541562) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is 4-[[[1-(2-phenylacetyl)piperidine-3-carbonyl]amino]methyl]oxane-4-carboxylic acid.
| Compound Name | 4-[[[1-(2-phenylacetyl)piperidine-3-carbonyl]amino]methyl]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 120541562 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 4-[[[1-(2-phenylacetyl)piperidine-3-carbonyl]amino]methyl]oxane-4-carboxylic acid |
| SMILES | O=C(NCC1(C(=O)O)CCOCC1)C1CCCN(C(=O)Cc2ccccc2)C1 |
| InChI | InChI=1S/C21H28N2O5/c24-18(13-16-5-2-1-3-6-16)23-10-4-7-17(14-23)19(25)22-15-21(20(26)27)8-11-28-12-9-21/h1-3,5-6,17H,4,7-15H2,(H,22,25)(H,26,27) |
| InChIKey | YEGWBXYPVQDUKU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |