C15H18N2O4 — CID 176713328
2-[[(3S)-1-(2-phenylacetyl)pyrrolidine-3-carbonyl]amino]acetic acid (PubChem CID 176713328) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-[[(3S)-1-(2-phenylacetyl)pyrrolidine-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[[(3S)-1-(2-phenylacetyl)pyrrolidine-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 176713328 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-[[(3S)-1-(2-phenylacetyl)pyrrolidine-3-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)[C@H]1CCN(C(=O)Cc2ccccc2)C1 |
| InChI | InChI=1S/C15H18N2O4/c18-13(8-11-4-2-1-3-5-11)17-7-6-12(10-17)15(21)16-9-14(19)20/h1-5,12H,6-10H2,(H,16,21)(H,19,20)/t12-/m0/s1 |
| InChIKey | ABUHYUOOXWFPEL-LBPRGKRZSA-N |
| XLogP | 0.28 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |