C15H19NO3 — CID 28997512
2-[1-(2-phenylacetyl)piperidin-4-yl]acetic acid (PubChem CID 28997512) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-[1-(2-phenylacetyl)piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-(2-phenylacetyl)piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 28997512 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 2-[1-(2-phenylacetyl)piperidin-4-yl]acetic acid |
| SMILES | O=C(O)CC1CCN(C(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C15H19NO3/c17-14(10-12-4-2-1-3-5-12)16-8-6-13(7-9-16)11-15(18)19/h1-5,13H,6-11H2,(H,18,19) |
| InChIKey | AXFIYYFYQXDOIP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |