C23H27NO3 — CID 119178891
2-[1-(3,4-diphenylbutanoyl)piperidin-4-yl]acetic acid (PubChem CID 119178891) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is 2-[1-(3,4-diphenylbutanoyl)piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-(3,4-diphenylbutanoyl)piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 119178891 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 2-[1-(3,4-diphenylbutanoyl)piperidin-4-yl]acetic acid |
| SMILES | O=C(O)CC1CCN(C(=O)CC(Cc2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H27NO3/c25-22(24-13-11-19(12-14-24)16-23(26)27)17-21(20-9-5-2-6-10-20)15-18-7-3-1-4-8-18/h1-10,19,21H,11-17H2,(H,26,27) |
| InChIKey | PMOADTWSIUCQHK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |