C22H25NO3 — CID 119257616
1-(3,4-diphenylbutanoyl)-3-methylpyrrolidine-3-carboxylic acid (PubChem CID 119257616) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is 1-(3,4-diphenylbutanoyl)-3-methylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-(3,4-diphenylbutanoyl)-3-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119257616 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 1-(3,4-diphenylbutanoyl)-3-methylpyrrolidine-3-carboxylic acid |
| SMILES | CC1(C(=O)O)CCN(C(=O)CC(Cc2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C22H25NO3/c1-22(21(25)26)12-13-23(16-22)20(24)15-19(18-10-6-3-7-11-18)14-17-8-4-2-5-9-17/h2-11,19H,12-16H2,1H3,(H,25,26) |
| InChIKey | BGOYHPIXCHHSDV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |