1-(2,2-diphenylacetyl)-3-methylpyrrolidine-3-carboxylic acid

C20H21NO3 — CID 119256443

IUPAC1-(2,2-diphenylacetyl)-3-methylpyrrolidine-3-carboxylic acid
SMILESCC1(C(=O)O)CCN(C(=O)C(c2ccccc2)c2ccccc2)C1
InChIInChI=1S/C20H21NO3/c1-20(19(23)24)12-13-21(14-20)18(22)17(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-11,17H,12-14H2,1H3,(H,23,24)
InChIKeyFQLPJDZDOBKMAB-UHFFFAOYSA-N
MW323.39 g/mol
LogP3.14
Rot. Bonds4

About 1-(2,2-diphenylacetyl)-3-methylpyrrolidine-3-carboxylic acid

1-(2,2-diphenylacetyl)-3-methylpyrrolidine-3-carboxylic acid (PubChem CID 119256443) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is 1-(2,2-diphenylacetyl)-3-methylpyrrolidine-3-carboxylic acid.

Molecular Properties

Compound Name1-(2,2-diphenylacetyl)-3-methylpyrrolidine-3-carboxylic acid
PubChem CID119256443
Molecular FormulaC20H21NO3
Molecular Weight323.39 g/mol
Exact Mass323.15
IUPAC Name1-(2,2-diphenylacetyl)-3-methylpyrrolidine-3-carboxylic acid
SMILESCC1(C(=O)O)CCN(C(=O)C(c2ccccc2)c2ccccc2)C1
InChIInChI=1S/C20H21NO3/c1-20(19(23)24)12-13-21(14-20)18(22)17(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-11,17H,12-14H2,1H3,(H,23,24)
InChIKeyFQLPJDZDOBKMAB-UHFFFAOYSA-N
XLogP3.14
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500323.39
LogP ≤ 53.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 1-(2,2-diphenylacetyl)-3-methylpyrrolidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2,2-diphenylacetyl)-3-methylpyrrolidine-3-carboxylic acid?
The IUPAC name of 1-(2,2-diphenylacetyl)-3-methylpyrrolidine-3-carboxylic acid (CID 119256443) is 1-(2,2-diphenylacetyl)-3-methylpyrrolidine-3-carboxylic acid.
What is the SMILES notation for 1-(2,2-diphenylacetyl)-3-methylpyrrolidine-3-carboxylic acid?
The canonical SMILES for 1-(2,2-diphenylacetyl)-3-methylpyrrolidine-3-carboxylic acid is CC1(C(=O)O)CCN(C(=O)C(c2ccccc2)c2ccccc2)C1.
What is the InChIKey of 1-(2,2-diphenylacetyl)-3-methylpyrrolidine-3-carboxylic acid?
The InChIKey is FQLPJDZDOBKMAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21NO3/c1-20(19(23)24)12-13-21(14-20)18(22)17(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-11,17H,12-14H2,1H3,(H,23,24).
What are the key properties of 1-(2,2-diphenylacetyl)-3-methylpyrrolidine-3-carboxylic acid?
1-(2,2-diphenylacetyl)-3-methylpyrrolidine-3-carboxylic acid has a molecular weight of 323.39 g/mol, XLogP of 3.14, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-diphenylacetyl)-3-methylpyrrolidine-3-carboxylic acid is sourced from PubChem (CID 119256443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).