C21H25NO3 — CID 84579916
1-(4,4-dimethoxypiperidin-1-yl)-2,2-diphenylethanone (PubChem CID 84579916) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-(4,4-dimethoxypiperidin-1-yl)-2,2-diphenylethanone.
| Compound Name | 1-(4,4-dimethoxypiperidin-1-yl)-2,2-diphenylethanone |
|---|---|
| PubChem CID | 84579916 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 1-(4,4-dimethoxypiperidin-1-yl)-2,2-diphenylethanone |
| SMILES | COC1(OC)CCN(C(=O)C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H25NO3/c1-24-21(25-2)13-15-22(16-14-21)20(23)19(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,19H,13-16H2,1-2H3 |
| InChIKey | LOEGQAACAOYUAK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|