C26H27NO2 — CID 143894081
1-[4-hydroxy-4-(4-methylphenyl)piperidin-1-yl]-2,2-diphenylethanone (PubChem CID 143894081) has the molecular formula C26H27NO2 and a molecular weight of 385.51 g/mol. Its IUPAC name is 1-[4-hydroxy-4-(4-methylphenyl)piperidin-1-yl]-2,2-diphenylethanone.
| Compound Name | 1-[4-hydroxy-4-(4-methylphenyl)piperidin-1-yl]-2,2-diphenylethanone |
|---|---|
| PubChem CID | 143894081 |
| Molecular Formula | C26H27NO2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 1-[4-hydroxy-4-(4-methylphenyl)piperidin-1-yl]-2,2-diphenylethanone |
| SMILES | Cc1ccc(C2(O)CCN(C(=O)C(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H27NO2/c1-20-12-14-23(15-13-20)26(29)16-18-27(19-17-26)25(28)24(21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-15,24,29H,16-19H2,1H3 |
| InChIKey | GFGRQULAQVLQON-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |