C20H25ClN2O — CID 119411312
1-[(3R)-3-aminopyrrolidin-1-yl]-3,4-diphenylbutan-1-one;hydrochloride (PubChem CID 119411312) has the molecular formula C20H25ClN2O and a molecular weight of 344.89 g/mol. Its IUPAC name is 1-[(3R)-3-aminopyrrolidin-1-yl]-3,4-diphenylbutan-1-one;hydrochloride.
| Compound Name | 1-[(3R)-3-aminopyrrolidin-1-yl]-3,4-diphenylbutan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119411312 |
| Molecular Formula | C20H25ClN2O |
| Molecular Weight | 344.89 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 1-[(3R)-3-aminopyrrolidin-1-yl]-3,4-diphenylbutan-1-one;hydrochloride |
| SMILES | Cl.N[C@@H]1CCN(C(=O)CC(Cc2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C20H24N2O.ClH/c21-19-11-12-22(15-19)20(23)14-18(17-9-5-2-6-10-17)13-16-7-3-1-4-8-16;/h1-10,18-19H,11-15,21H2;1H/t18?,19-;/m1./s1 |
| InChIKey | RYIQGZASOUCAIB-SQTGWKPBSA-N |
| XLogP | 3.38 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.89 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |