C21H23NO3 — CID 119364861
(2S)-1-(3,4-diphenylbutanoyl)pyrrolidine-2-carboxylic acid (PubChem CID 119364861) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is (2S)-1-(3,4-diphenylbutanoyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-(3,4-diphenylbutanoyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 119364861 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | (2S)-1-(3,4-diphenylbutanoyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1C(=O)CC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H23NO3/c23-20(22-13-7-12-19(22)21(24)25)15-18(17-10-5-2-6-11-17)14-16-8-3-1-4-9-16/h1-6,8-11,18-19H,7,12-15H2,(H,24,25)/t18?,19-/m0/s1 |
| InChIKey | CZVMUXFFJNJINF-GGYWPGCISA-N |
| XLogP | 3.48 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |