C20H21NO3 — CID 22665663
1-(3,3-diphenylpropanoyl)pyrrolidine-2-carboxylic acid (PubChem CID 22665663) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is 1-(3,3-diphenylpropanoyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 1-(3,3-diphenylpropanoyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 22665663 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 1-(3,3-diphenylpropanoyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCN1C(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H21NO3/c22-19(21-13-7-12-18(21)20(23)24)14-17(15-8-3-1-4-9-15)16-10-5-2-6-11-16/h1-6,8-11,17-18H,7,12-14H2,(H,23,24) |
| InChIKey | QQGQFKZIZJOOSL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |