C16H21NO4 — CID 124688281
(2R)-1-[(3R)-3-(3-methoxyphenyl)butanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 124688281) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is (2R)-1-[(3R)-3-(3-methoxyphenyl)butanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[(3R)-3-(3-methoxyphenyl)butanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 124688281 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | (2R)-1-[(3R)-3-(3-methoxyphenyl)butanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | COc1cccc([C@H](C)CC(=O)N2CCC[C@@H]2C(=O)O)c1 |
| InChI | InChI=1S/C16H21NO4/c1-11(12-5-3-6-13(10-12)21-2)9-15(18)17-8-4-7-14(17)16(19)20/h3,5-6,10-11,14H,4,7-9H2,1-2H3,(H,19,20)/t11-,14-/m1/s1 |
| InChIKey | XKDAFOSPVQHIIP-BXUZGUMPSA-N |
| XLogP | 2.26 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |