C17H18N2O5 — CID 164643870
(2R)-1-[3-(1,3-dioxoisoindol-2-yl)butanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 164643870) has the molecular formula C17H18N2O5 and a molecular weight of 330.34 g/mol. Its IUPAC name is (2R)-1-[3-(1,3-dioxoisoindol-2-yl)butanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[3-(1,3-dioxoisoindol-2-yl)butanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 164643870 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | (2R)-1-[3-(1,3-dioxoisoindol-2-yl)butanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(CC(=O)N1CCC[C@@H]1C(=O)O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H18N2O5/c1-10(9-14(20)18-8-4-7-13(18)17(23)24)19-15(21)11-5-2-3-6-12(11)16(19)22/h2-3,5-6,10,13H,4,7-9H2,1H3,(H,23,24)/t10?,13-/m1/s1 |
| InChIKey | NXMBCDBMDGOSCN-JLOHTSLTSA-N |
| XLogP | 1.14 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|