C24H28FN3O5S — CID 55605523
N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)-1-(2-phenylacetyl)piperidine-3-carboxamide (PubChem CID 55605523) has the molecular formula C24H28FN3O5S and a molecular weight of 489.57 g/mol. Its IUPAC name is N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)-1-(2-phenylacetyl)piperidine-3-carboxamide.
| Compound Name | N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)-1-(2-phenylacetyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55605523 |
| Molecular Formula | C24H28FN3O5S |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)-1-(2-phenylacetyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(S(=O)(=O)N2CCOCC2)c1)C1CCCN(C(=O)Cc2ccccc2)C1 |
| InChI | InChI=1S/C24H28FN3O5S/c25-21-9-8-20(16-22(21)34(31,32)28-11-13-33-14-12-28)26-24(30)19-7-4-10-27(17-19)23(29)15-18-5-2-1-3-6-18/h1-3,5-6,8-9,16,19H,4,7,10-15,17H2,(H,26,30) |
| InChIKey | SNSLMBQGYOYNCL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |