C11H22N4O2 — CID 79162286
N,N-diethyl-3-(N'-hydroxycarbamimidoyl)piperidine-1-carboxamide (PubChem CID 79162286) has the molecular formula C11H22N4O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is N,N-diethyl-3-(N'-hydroxycarbamimidoyl)piperidine-1-carboxamide.
| Compound Name | N,N-diethyl-3-(N'-hydroxycarbamimidoyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 79162286 |
| Molecular Formula | C11H22N4O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | N,N-diethyl-3-(N'-hydroxycarbamimidoyl)piperidine-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCCC(C(N)=NO)C1 |
| InChI | InChI=1S/C11H22N4O2/c1-3-14(4-2)11(16)15-7-5-6-9(8-15)10(12)13-17/h9,17H,3-8H2,1-2H3,(H2,12,13) |
| InChIKey | KFJCUDMOWYDRDR-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|