C10H21N3O3S — CID 79162189
N,N-diethyl-3-sulfamoylpiperidine-1-carboxamide (PubChem CID 79162189) has the molecular formula C10H21N3O3S and a molecular weight of 263.36 g/mol. Its IUPAC name is N,N-diethyl-3-sulfamoylpiperidine-1-carboxamide.
| Compound Name | N,N-diethyl-3-sulfamoylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 79162189 |
| Molecular Formula | C10H21N3O3S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N,N-diethyl-3-sulfamoylpiperidine-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCCC(S(N)(=O)=O)C1 |
| InChI | InChI=1S/C10H21N3O3S/c1-3-12(4-2)10(14)13-7-5-6-9(8-13)17(11,15)16/h9H,3-8H2,1-2H3,(H2,11,15,16) |
| InChIKey | OKAKJGHQPGPJBK-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |