C12H22N2O4S — CID 103522077
1-[2-(1-methoxycyclobutyl)acetyl]piperidine-3-sulfonamide (PubChem CID 103522077) has the molecular formula C12H22N2O4S and a molecular weight of 290.39 g/mol. Its IUPAC name is 1-[2-(1-methoxycyclobutyl)acetyl]piperidine-3-sulfonamide.
| Compound Name | 1-[2-(1-methoxycyclobutyl)acetyl]piperidine-3-sulfonamide |
|---|---|
| PubChem CID | 103522077 |
| Molecular Formula | C12H22N2O4S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 1-[2-(1-methoxycyclobutyl)acetyl]piperidine-3-sulfonamide |
| SMILES | COC1(CC(=O)N2CCCC(S(N)(=O)=O)C2)CCC1 |
| InChI | InChI=1S/C12H22N2O4S/c1-18-12(5-3-6-12)8-11(15)14-7-2-4-10(9-14)19(13,16)17/h10H,2-9H2,1H3,(H2,13,16,17) |
| InChIKey | QAWXCIHQFPWABO-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |