C12H20N4O3S — CID 64867620
1-(2-ethyl-5-methylpyrazole-3-carbonyl)piperidine-3-sulfonamide (PubChem CID 64867620) has the molecular formula C12H20N4O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is 1-(2-ethyl-5-methylpyrazole-3-carbonyl)piperidine-3-sulfonamide.
| Compound Name | 1-(2-ethyl-5-methylpyrazole-3-carbonyl)piperidine-3-sulfonamide |
|---|---|
| PubChem CID | 64867620 |
| Molecular Formula | C12H20N4O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 1-(2-ethyl-5-methylpyrazole-3-carbonyl)piperidine-3-sulfonamide |
| SMILES | CCn1nc(C)cc1C(=O)N1CCCC(S(N)(=O)=O)C1 |
| InChI | InChI=1S/C12H20N4O3S/c1-3-16-11(7-9(2)14-16)12(17)15-6-4-5-10(8-15)20(13,18)19/h7,10H,3-6,8H2,1-2H3,(H2,13,18,19) |
| InChIKey | SMQZWLDSNVGJMX-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |