C13H19N3O3S — CID 62830617
1-(2,6-dimethylpyridine-3-carbonyl)piperidine-3-sulfonamide (PubChem CID 62830617) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is 1-(2,6-dimethylpyridine-3-carbonyl)piperidine-3-sulfonamide.
| Compound Name | 1-(2,6-dimethylpyridine-3-carbonyl)piperidine-3-sulfonamide |
|---|---|
| PubChem CID | 62830617 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 1-(2,6-dimethylpyridine-3-carbonyl)piperidine-3-sulfonamide |
| SMILES | Cc1ccc(C(=O)N2CCCC(S(N)(=O)=O)C2)c(C)n1 |
| InChI | InChI=1S/C13H19N3O3S/c1-9-5-6-12(10(2)15-9)13(17)16-7-3-4-11(8-16)20(14,18)19/h5-6,11H,3-4,7-8H2,1-2H3,(H2,14,18,19) |
| InChIKey | KPONLYLWRZVJPN-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |