C14H19ClN2O — CID 114683136
(4-chloro-3-methylpiperidin-1-yl)-(2,6-dimethyl-3-pyridinyl)methanone (PubChem CID 114683136) has the molecular formula C14H19ClN2O and a molecular weight of 266.77 g/mol. Its IUPAC name is (4-chloro-3-methylpiperidin-1-yl)-(2,6-dimethyl-3-pyridinyl)methanone.
| Compound Name | (4-chloro-3-methylpiperidin-1-yl)-(2,6-dimethyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 114683136 |
| Molecular Formula | C14H19ClN2O |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | (4-chloro-3-methylpiperidin-1-yl)-(2,6-dimethyl-3-pyridinyl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCC(Cl)C(C)C2)c(C)n1 |
| InChI | InChI=1S/C14H19ClN2O/c1-9-8-17(7-6-13(9)15)14(18)12-5-4-10(2)16-11(12)3/h4-5,9,13H,6-8H2,1-3H3 |
| InChIKey | BVGHTKQYRKKCSY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|