C14H17Cl2NO — CID 106864067
(2-chloro-4-methylphenyl)-(4-chloro-3-methylpiperidin-1-yl)methanone (PubChem CID 106864067) has the molecular formula C14H17Cl2NO and a molecular weight of 286.20 g/mol. Its IUPAC name is (2-chloro-4-methylphenyl)-(4-chloro-3-methylpiperidin-1-yl)methanone.
| Compound Name | (2-chloro-4-methylphenyl)-(4-chloro-3-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 106864067 |
| Molecular Formula | C14H17Cl2NO |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | (2-chloro-4-methylphenyl)-(4-chloro-3-methylpiperidin-1-yl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCC(Cl)C(C)C2)c(Cl)c1 |
| InChI | InChI=1S/C14H17Cl2NO/c1-9-3-4-11(13(16)7-9)14(18)17-6-5-12(15)10(2)8-17/h3-4,7,10,12H,5-6,8H2,1-2H3 |
| InChIKey | YDGWQYLRFBGJPM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|