C8H12F3N3O3 — CID 49471765
4-N-(2,2,2-trifluoroethyl)morpholine-2,4-dicarboxamide (PubChem CID 49471765) has the molecular formula C8H12F3N3O3 and a molecular weight of 255.20 g/mol. Its IUPAC name is 4-N-(2,2,2-trifluoroethyl)morpholine-2,4-dicarboxamide.
| Compound Name | 4-N-(2,2,2-trifluoroethyl)morpholine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 49471765 |
| Molecular Formula | C8H12F3N3O3 |
| Molecular Weight | 255.20 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 4-N-(2,2,2-trifluoroethyl)morpholine-2,4-dicarboxamide |
| SMILES | NC(=O)C1CN(C(=O)NCC(F)(F)F)CCO1 |
| InChI | InChI=1S/C8H12F3N3O3/c9-8(10,11)4-13-7(16)14-1-2-17-5(3-14)6(12)15/h5H,1-4H2,(H2,12,15)(H,13,16) |
| InChIKey | NEZMSDUDGIAIDN-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.20 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |