C10H16N2O6 — CID 113498394
2-[(3-methoxycarbonylpiperidine-1-carbonyl)amino]oxyacetic acid (PubChem CID 113498394) has the molecular formula C10H16N2O6 and a molecular weight of 260.25 g/mol. Its IUPAC name is 2-[(3-methoxycarbonylpiperidine-1-carbonyl)amino]oxyacetic acid.
| Compound Name | 2-[(3-methoxycarbonylpiperidine-1-carbonyl)amino]oxyacetic acid |
|---|---|
| PubChem CID | 113498394 |
| Molecular Formula | C10H16N2O6 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 2-[(3-methoxycarbonylpiperidine-1-carbonyl)amino]oxyacetic acid |
| SMILES | COC(=O)C1CCCN(C(=O)NOCC(=O)O)C1 |
| InChI | InChI=1S/C10H16N2O6/c1-17-9(15)7-3-2-4-12(5-7)10(16)11-18-6-8(13)14/h7H,2-6H2,1H3,(H,11,16)(H,13,14) |
| InChIKey | QQJSHFSYJWIUHF-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|