C10H16N6O2 — CID 78927822
3-N-(5-methyl-1H-1,2,4-triazol-3-yl)piperidine-1,3-dicarboxamide (PubChem CID 78927822) has the molecular formula C10H16N6O2 and a molecular weight of 252.28 g/mol. Its IUPAC name is 3-N-(5-methyl-1H-1,2,4-triazol-3-yl)piperidine-1,3-dicarboxamide.
| Compound Name | 3-N-(5-methyl-1H-1,2,4-triazol-3-yl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 78927822 |
| Molecular Formula | C10H16N6O2 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 3-N-(5-methyl-1H-1,2,4-triazol-3-yl)piperidine-1,3-dicarboxamide |
| SMILES | Cc1nc(NC(=O)C2CCCN(C(N)=O)C2)n[nH]1 |
| InChI | InChI=1S/C10H16N6O2/c1-6-12-10(15-14-6)13-8(17)7-3-2-4-16(5-7)9(11)18/h7H,2-5H2,1H3,(H2,11,18)(H2,12,13,14,15,17) |
| InChIKey | HIRCGERTCVQHSF-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |