C8H12N4OS — CID 80709247
N-(5-methyl-1H-1,2,4-triazol-3-yl)thiolane-3-carboxamide (PubChem CID 80709247) has the molecular formula C8H12N4OS and a molecular weight of 212.28 g/mol. Its IUPAC name is N-(5-methyl-1H-1,2,4-triazol-3-yl)thiolane-3-carboxamide.
| Compound Name | N-(5-methyl-1H-1,2,4-triazol-3-yl)thiolane-3-carboxamide |
|---|---|
| PubChem CID | 80709247 |
| Molecular Formula | C8H12N4OS |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | N-(5-methyl-1H-1,2,4-triazol-3-yl)thiolane-3-carboxamide |
| SMILES | Cc1nc(NC(=O)C2CCSC2)n[nH]1 |
| InChI | InChI=1S/C8H12N4OS/c1-5-9-8(12-11-5)10-7(13)6-2-3-14-4-6/h6H,2-4H2,1H3,(H2,9,10,11,12,13) |
| InChIKey | MJGQYKFPQQAICU-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |