C12H15NO2S — CID 64795102
N-(3-hydroxy-2-methylphenyl)thiolane-3-carboxamide (PubChem CID 64795102) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is N-(3-hydroxy-2-methylphenyl)thiolane-3-carboxamide.
| Compound Name | N-(3-hydroxy-2-methylphenyl)thiolane-3-carboxamide |
|---|---|
| PubChem CID | 64795102 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | N-(3-hydroxy-2-methylphenyl)thiolane-3-carboxamide |
| SMILES | Cc1c(O)cccc1NC(=O)C1CCSC1 |
| InChI | InChI=1S/C12H15NO2S/c1-8-10(3-2-4-11(8)14)13-12(15)9-5-6-16-7-9/h2-4,9,14H,5-7H2,1H3,(H,13,15) |
| InChIKey | RKIIYNNTORSPLT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |