C14H13BrN2OS — CID 116784684
N-(3-bromoquinolin-8-yl)thiolane-3-carboxamide (PubChem CID 116784684) has the molecular formula C14H13BrN2OS and a molecular weight of 337.24 g/mol. Its IUPAC name is N-(3-bromoquinolin-8-yl)thiolane-3-carboxamide.
| Compound Name | N-(3-bromoquinolin-8-yl)thiolane-3-carboxamide |
|---|---|
| PubChem CID | 116784684 |
| Molecular Formula | C14H13BrN2OS |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | N-(3-bromoquinolin-8-yl)thiolane-3-carboxamide |
| SMILES | O=C(Nc1cccc2cc(Br)cnc12)C1CCSC1 |
| InChI | InChI=1S/C14H13BrN2OS/c15-11-6-9-2-1-3-12(13(9)16-7-11)17-14(18)10-4-5-19-8-10/h1-3,6-7,10H,4-5,8H2,(H,17,18) |
| InChIKey | YOQZURPUIWXMEN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |