C13H12BrN3OS — CID 116784376
N-(3-bromoquinolin-8-yl)-1,3-thiazolidine-4-carboxamide (PubChem CID 116784376) has the molecular formula C13H12BrN3OS and a molecular weight of 338.23 g/mol. Its IUPAC name is N-(3-bromoquinolin-8-yl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(3-bromoquinolin-8-yl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 116784376 |
| Molecular Formula | C13H12BrN3OS |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | N-(3-bromoquinolin-8-yl)-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C(Nc1cccc2cc(Br)cnc12)C1CSCN1 |
| InChI | InChI=1S/C13H12BrN3OS/c14-9-4-8-2-1-3-10(12(8)15-5-9)17-13(18)11-6-19-7-16-11/h1-5,11,16H,6-7H2,(H,17,18) |
| InChIKey | UBQOTBCJLMTPQF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |