C10H10BrClN2OS — CID 62908918
N-(5-bromo-2-chlorophenyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 62908918) has the molecular formula C10H10BrClN2OS and a molecular weight of 321.63 g/mol. Its IUPAC name is N-(5-bromo-2-chlorophenyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(5-bromo-2-chlorophenyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 62908918 |
| Molecular Formula | C10H10BrClN2OS |
| Molecular Weight | 321.63 g/mol |
| Exact Mass | 319.94 |
| IUPAC Name | N-(5-bromo-2-chlorophenyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C(Nc1cc(Br)ccc1Cl)C1CSCN1 |
| InChI | InChI=1S/C10H10BrClN2OS/c11-6-1-2-7(12)8(3-6)14-10(15)9-4-16-5-13-9/h1-3,9,13H,4-5H2,(H,14,15) |
| InChIKey | SYXAZRHBANKYGW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.63 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |