C10H12BrN3O3S2 — CID 43711294
N-(2-bromo-4-sulfamoylphenyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 43711294) has the molecular formula C10H12BrN3O3S2 and a molecular weight of 366.26 g/mol. Its IUPAC name is N-(2-bromo-4-sulfamoylphenyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(2-bromo-4-sulfamoylphenyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 43711294 |
| Molecular Formula | C10H12BrN3O3S2 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 364.95 |
| IUPAC Name | N-(2-bromo-4-sulfamoylphenyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)C2CSCN2)c(Br)c1 |
| InChI | InChI=1S/C10H12BrN3O3S2/c11-7-3-6(19(12,16)17)1-2-8(7)14-10(15)9-4-18-5-13-9/h1-3,9,13H,4-5H2,(H,14,15)(H2,12,16,17) |
| InChIKey | XZUKDNKBZLTIOG-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |