C11H12Br2N2O2S — CID 103413589
N-(2,4-dibromo-5-methoxyphenyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 103413589) has the molecular formula C11H12Br2N2O2S and a molecular weight of 396.10 g/mol. Its IUPAC name is N-(2,4-dibromo-5-methoxyphenyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(2,4-dibromo-5-methoxyphenyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 103413589 |
| Molecular Formula | C11H12Br2N2O2S |
| Molecular Weight | 396.10 g/mol |
| Exact Mass | 393.90 |
| IUPAC Name | N-(2,4-dibromo-5-methoxyphenyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | COc1cc(NC(=O)C2CSCN2)c(Br)cc1Br |
| InChI | InChI=1S/C11H12Br2N2O2S/c1-17-10-3-8(6(12)2-7(10)13)15-11(16)9-4-18-5-14-9/h2-3,9,14H,4-5H2,1H3,(H,15,16) |
| InChIKey | IYSUJYFHGXVORB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.10 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |