C12H12F2N2O3S — CID 43712858
methyl 2,4-difluoro-5-(1,3-thiazolidine-4-carbonylamino)benzoate (PubChem CID 43712858) has the molecular formula C12H12F2N2O3S and a molecular weight of 302.30 g/mol. Its IUPAC name is methyl 2,4-difluoro-5-(1,3-thiazolidine-4-carbonylamino)benzoate.
| Compound Name | methyl 2,4-difluoro-5-(1,3-thiazolidine-4-carbonylamino)benzoate |
|---|---|
| PubChem CID | 43712858 |
| Molecular Formula | C12H12F2N2O3S |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | methyl 2,4-difluoro-5-(1,3-thiazolidine-4-carbonylamino)benzoate |
| SMILES | COC(=O)c1cc(NC(=O)C2CSCN2)c(F)cc1F |
| InChI | InChI=1S/C12H12F2N2O3S/c1-19-12(18)6-2-9(8(14)3-7(6)13)16-11(17)10-4-20-5-15-10/h2-3,10,15H,4-5H2,1H3,(H,16,17) |
| InChIKey | QFKWPZQBNKFKOY-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |