C11H13FN2O3S2 — CID 43708243
N-(2-fluoro-5-methylsulfonylphenyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 43708243) has the molecular formula C11H13FN2O3S2 and a molecular weight of 304.37 g/mol. Its IUPAC name is N-(2-fluoro-5-methylsulfonylphenyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(2-fluoro-5-methylsulfonylphenyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 43708243 |
| Molecular Formula | C11H13FN2O3S2 |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | N-(2-fluoro-5-methylsulfonylphenyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(F)c(NC(=O)C2CSCN2)c1 |
| InChI | InChI=1S/C11H13FN2O3S2/c1-19(16,17)7-2-3-8(12)9(4-7)14-11(15)10-5-18-6-13-10/h2-4,10,13H,5-6H2,1H3,(H,14,15) |
| InChIKey | JTTKWICEHJONMZ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |