C11H14N2O4S2 — CID 81433795
N-(2-hydroxy-5-methylsulfonylphenyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 81433795) has the molecular formula C11H14N2O4S2 and a molecular weight of 302.38 g/mol. Its IUPAC name is N-(2-hydroxy-5-methylsulfonylphenyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(2-hydroxy-5-methylsulfonylphenyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 81433795 |
| Molecular Formula | C11H14N2O4S2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | N-(2-hydroxy-5-methylsulfonylphenyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(O)c(NC(=O)C2CSCN2)c1 |
| InChI | InChI=1S/C11H14N2O4S2/c1-19(16,17)7-2-3-10(14)8(4-7)13-11(15)9-5-18-6-12-9/h2-4,9,12,14H,5-6H2,1H3,(H,13,15) |
| InChIKey | CQLRBPMGGYDTPI-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|