C12H15N3O5S — CID 107437267
N-(2-hydroxy-5-methylsulfonylphenyl)-5-oxopiperazine-2-carboxamide (PubChem CID 107437267) has the molecular formula C12H15N3O5S and a molecular weight of 313.34 g/mol. Its IUPAC name is N-(2-hydroxy-5-methylsulfonylphenyl)-5-oxopiperazine-2-carboxamide.
| Compound Name | N-(2-hydroxy-5-methylsulfonylphenyl)-5-oxopiperazine-2-carboxamide |
|---|---|
| PubChem CID | 107437267 |
| Molecular Formula | C12H15N3O5S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | N-(2-hydroxy-5-methylsulfonylphenyl)-5-oxopiperazine-2-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(O)c(NC(=O)C2CNC(=O)CN2)c1 |
| InChI | InChI=1S/C12H15N3O5S/c1-21(19,20)7-2-3-10(16)8(4-7)15-12(18)9-5-14-11(17)6-13-9/h2-4,9,13,16H,5-6H2,1H3,(H,14,17)(H,15,18) |
| InChIKey | NVHFDFPUSNDISV-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|