C13H17BrN4O2 — CID 107434603
N-[5-bromo-2-(dimethylamino)phenyl]-5-oxopiperazine-2-carboxamide (PubChem CID 107434603) has the molecular formula C13H17BrN4O2 and a molecular weight of 341.21 g/mol. Its IUPAC name is N-[5-bromo-2-(dimethylamino)phenyl]-5-oxopiperazine-2-carboxamide.
| Compound Name | N-[5-bromo-2-(dimethylamino)phenyl]-5-oxopiperazine-2-carboxamide |
|---|---|
| PubChem CID | 107434603 |
| Molecular Formula | C13H17BrN4O2 |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | N-[5-bromo-2-(dimethylamino)phenyl]-5-oxopiperazine-2-carboxamide |
| SMILES | CN(C)c1ccc(Br)cc1NC(=O)C1CNC(=O)CN1 |
| InChI | InChI=1S/C13H17BrN4O2/c1-18(2)11-4-3-8(14)5-9(11)17-13(20)10-6-16-12(19)7-15-10/h3-5,10,15H,6-7H2,1-2H3,(H,16,19)(H,17,20) |
| InChIKey | JULXXLUXCGGDKD-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |