C15H22BrN3O — CID 106739102
N-[5-bromo-2-(dimethylamino)phenyl]-2-methylpiperidine-4-carboxamide (PubChem CID 106739102) has the molecular formula C15H22BrN3O and a molecular weight of 340.27 g/mol. Its IUPAC name is N-[5-bromo-2-(dimethylamino)phenyl]-2-methylpiperidine-4-carboxamide.
| Compound Name | N-[5-bromo-2-(dimethylamino)phenyl]-2-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 106739102 |
| Molecular Formula | C15H22BrN3O |
| Molecular Weight | 340.27 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | N-[5-bromo-2-(dimethylamino)phenyl]-2-methylpiperidine-4-carboxamide |
| SMILES | CC1CC(C(=O)Nc2cc(Br)ccc2N(C)C)CCN1 |
| InChI | InChI=1S/C15H22BrN3O/c1-10-8-11(6-7-17-10)15(20)18-13-9-12(16)4-5-14(13)19(2)3/h4-5,9-11,17H,6-8H2,1-3H3,(H,18,20) |
| InChIKey | XBPLTWZFSJBIFB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |