C10H13BrN2O — CID 60651446
N-[5-bromo-2-(dimethylamino)phenyl]acetamide (PubChem CID 60651446) has the molecular formula C10H13BrN2O and a molecular weight of 257.13 g/mol. Its IUPAC name is N-[5-bromo-2-(dimethylamino)phenyl]acetamide.
| Compound Name | N-[5-bromo-2-(dimethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 60651446 |
| Molecular Formula | C10H13BrN2O |
| Molecular Weight | 257.13 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | N-[5-bromo-2-(dimethylamino)phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(Br)ccc1N(C)C |
| InChI | InChI=1S/C10H13BrN2O/c1-7(14)12-9-6-8(11)4-5-10(9)13(2)3/h4-6H,1-3H3,(H,12,14) |
| InChIKey | CVLKFEJFARXPHG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.13 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |