C11H12BrF3N2O2 — CID 65173773
2,2,2-trifluoroethyl N-[5-bromo-2-(dimethylamino)phenyl]carbamate (PubChem CID 65173773) has the molecular formula C11H12BrF3N2O2 and a molecular weight of 341.13 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[5-bromo-2-(dimethylamino)phenyl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[5-bromo-2-(dimethylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 65173773 |
| Molecular Formula | C11H12BrF3N2O2 |
| Molecular Weight | 341.13 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[5-bromo-2-(dimethylamino)phenyl]carbamate |
| SMILES | CN(C)c1ccc(Br)cc1NC(=O)OCC(F)(F)F |
| InChI | InChI=1S/C11H12BrF3N2O2/c1-17(2)9-4-3-7(12)5-8(9)16-10(18)19-6-11(13,14)15/h3-5H,6H2,1-2H3,(H,16,18) |
| InChIKey | SFVBGFFVLXHKGW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.13 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |