C9H6BrClF3NO2 — CID 81271801
2,2,2-trifluoroethyl N-(2-bromo-5-chlorophenyl)carbamate (PubChem CID 81271801) has the molecular formula C9H6BrClF3NO2 and a molecular weight of 332.50 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-(2-bromo-5-chlorophenyl)carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-(2-bromo-5-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 81271801 |
| Molecular Formula | C9H6BrClF3NO2 |
| Molecular Weight | 332.50 g/mol |
| Exact Mass | 330.92 |
| IUPAC Name | 2,2,2-trifluoroethyl N-(2-bromo-5-chlorophenyl)carbamate |
| SMILES | O=C(Nc1cc(Cl)ccc1Br)OCC(F)(F)F |
| InChI | InChI=1S/C9H6BrClF3NO2/c10-6-2-1-5(11)3-7(6)15-8(16)17-4-9(12,13)14/h1-3H,4H2,(H,15,16) |
| InChIKey | UUBQZPLAQVBIGO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |