C11H13N3O3 — CID 107434569
N-(4-hydroxyphenyl)-5-oxopiperazine-2-carboxamide (PubChem CID 107434569) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-5-oxopiperazine-2-carboxamide.
| Compound Name | N-(4-hydroxyphenyl)-5-oxopiperazine-2-carboxamide |
|---|---|
| PubChem CID | 107434569 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | N-(4-hydroxyphenyl)-5-oxopiperazine-2-carboxamide |
| SMILES | O=C1CNC(C(=O)Nc2ccc(O)cc2)CN1 |
| InChI | InChI=1S/C11H13N3O3/c15-8-3-1-7(2-4-8)14-11(17)9-5-13-10(16)6-12-9/h1-4,9,12,15H,5-6H2,(H,13,16)(H,14,17) |
| InChIKey | RZNXSRILLUERKW-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|