C13H14F3N3O2 — CID 107436129
N-[4-methyl-3-(trifluoromethyl)phenyl]-5-oxopiperazine-2-carboxamide (PubChem CID 107436129) has the molecular formula C13H14F3N3O2 and a molecular weight of 301.27 g/mol. Its IUPAC name is N-[4-methyl-3-(trifluoromethyl)phenyl]-5-oxopiperazine-2-carboxamide.
| Compound Name | N-[4-methyl-3-(trifluoromethyl)phenyl]-5-oxopiperazine-2-carboxamide |
|---|---|
| PubChem CID | 107436129 |
| Molecular Formula | C13H14F3N3O2 |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | N-[4-methyl-3-(trifluoromethyl)phenyl]-5-oxopiperazine-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CNC(=O)CN2)cc1C(F)(F)F |
| InChI | InChI=1S/C13H14F3N3O2/c1-7-2-3-8(4-9(7)13(14,15)16)19-12(21)10-5-18-11(20)6-17-10/h2-4,10,17H,5-6H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | QSEKIRRTJXEYRU-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |