C13H12N4O4 — CID 107433664
N-(1,3-dioxoisoindol-5-yl)-5-oxopiperazine-2-carboxamide (PubChem CID 107433664) has the molecular formula C13H12N4O4 and a molecular weight of 288.26 g/mol. Its IUPAC name is N-(1,3-dioxoisoindol-5-yl)-5-oxopiperazine-2-carboxamide.
| Compound Name | N-(1,3-dioxoisoindol-5-yl)-5-oxopiperazine-2-carboxamide |
|---|---|
| PubChem CID | 107433664 |
| Molecular Formula | C13H12N4O4 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | N-(1,3-dioxoisoindol-5-yl)-5-oxopiperazine-2-carboxamide |
| SMILES | O=C1CNC(C(=O)Nc2ccc3c(c2)C(=O)NC3=O)CN1 |
| InChI | InChI=1S/C13H12N4O4/c18-10-5-14-9(4-15-10)13(21)16-6-1-2-7-8(3-6)12(20)17-11(7)19/h1-3,9,14H,4-5H2,(H,15,18)(H,16,21)(H,17,19,20) |
| InChIKey | DSQYWBJSXBMQEX-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|