C11H11FN4O4 — CID 107437353
N-(3-fluoro-4-nitrophenyl)-5-oxopiperazine-2-carboxamide (PubChem CID 107437353) has the molecular formula C11H11FN4O4 and a molecular weight of 282.23 g/mol. Its IUPAC name is N-(3-fluoro-4-nitrophenyl)-5-oxopiperazine-2-carboxamide.
| Compound Name | N-(3-fluoro-4-nitrophenyl)-5-oxopiperazine-2-carboxamide |
|---|---|
| PubChem CID | 107437353 |
| Molecular Formula | C11H11FN4O4 |
| Molecular Weight | 282.23 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | N-(3-fluoro-4-nitrophenyl)-5-oxopiperazine-2-carboxamide |
| SMILES | O=C1CNC(C(=O)Nc2ccc([N+](=O)[O-])c(F)c2)CN1 |
| InChI | InChI=1S/C11H11FN4O4/c12-7-3-6(1-2-9(7)16(19)20)15-11(18)8-4-14-10(17)5-13-8/h1-3,8,13H,4-5H2,(H,14,17)(H,15,18) |
| InChIKey | CJEHJTIXZVPINT-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.23 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|