C12H13N3O4 — CID 78981663
N-(4-methyl-3-nitrophenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 78981663) has the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. Its IUPAC name is N-(4-methyl-3-nitrophenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-(4-methyl-3-nitrophenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 78981663 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | N-(4-methyl-3-nitrophenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CNC(=O)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13N3O4/c1-7-2-3-9(5-10(7)15(18)19)14-12(17)8-4-11(16)13-6-8/h2-3,5,8H,4,6H2,1H3,(H,13,16)(H,14,17) |
| InChIKey | HPXJNKPOIMSOFU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|