C11H10ClN3O4 — CID 83193218
N-(5-chloro-2-nitrophenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 83193218) has the molecular formula C11H10ClN3O4 and a molecular weight of 283.67 g/mol. Its IUPAC name is N-(5-chloro-2-nitrophenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-(5-chloro-2-nitrophenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 83193218 |
| Molecular Formula | C11H10ClN3O4 |
| Molecular Weight | 283.67 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | N-(5-chloro-2-nitrophenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C1CC(C(=O)Nc2cc(Cl)ccc2[N+](=O)[O-])CN1 |
| InChI | InChI=1S/C11H10ClN3O4/c12-7-1-2-9(15(18)19)8(4-7)14-11(17)6-3-10(16)13-5-6/h1-2,4,6H,3,5H2,(H,13,16)(H,14,17) |
| InChIKey | GQHPXXIVKMXQQA-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.67 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|