C11H9Cl3N2O2 — CID 78981558
5-oxo-N-(2,4,5-trichlorophenyl)pyrrolidine-3-carboxamide (PubChem CID 78981558) has the molecular formula C11H9Cl3N2O2 and a molecular weight of 307.56 g/mol. Its IUPAC name is 5-oxo-N-(2,4,5-trichlorophenyl)pyrrolidine-3-carboxamide.
| Compound Name | 5-oxo-N-(2,4,5-trichlorophenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 78981558 |
| Molecular Formula | C11H9Cl3N2O2 |
| Molecular Weight | 307.56 g/mol |
| Exact Mass | 305.97 |
| IUPAC Name | 5-oxo-N-(2,4,5-trichlorophenyl)pyrrolidine-3-carboxamide |
| SMILES | O=C1CC(C(=O)Nc2cc(Cl)c(Cl)cc2Cl)CN1 |
| InChI | InChI=1S/C11H9Cl3N2O2/c12-6-2-8(14)9(3-7(6)13)16-11(18)5-1-10(17)15-4-5/h2-3,5H,1,4H2,(H,15,17)(H,16,18) |
| InChIKey | GVHHWNMSIOIWSB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.56 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|