C12H15N3O4S — CID 78983436
N-(4-methyl-3-sulfamoylphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 78983436) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is N-(4-methyl-3-sulfamoylphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-(4-methyl-3-sulfamoylphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 78983436 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | N-(4-methyl-3-sulfamoylphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CNC(=O)C2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C12H15N3O4S/c1-7-2-3-9(5-10(7)20(13,18)19)15-12(17)8-4-11(16)14-6-8/h2-3,5,8H,4,6H2,1H3,(H,14,16)(H,15,17)(H2,13,18,19) |
| InChIKey | CJCSHWQHRMXVEW-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |